EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18O3 |
| Net Charge | 0 |
| Average Mass | 234.295 |
| Monoisotopic Mass | 234.12559 |
| SMILES | O=C(O)/C(=C\c1ccccc1)CCCCCO |
| InChI | InChI=1S/C14H18O3/c15-10-6-2-5-9-13(14(16)17)11-12-7-3-1-4-8-12/h1,3-4,7-8,11,15H,2,5-6,9-10H2,(H,16,17)/b13-11- |
| InChIKey | RXRICHSXXMJQJH-QBFSEMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2Z)-7-hydroxy-2-(phenylmethylidene)heptanoic acid (CHEBI:186743) is a cinnamic acids (CHEBI:23252) |
| IUPAC Name |
|---|
| (2Z)-2-benzylidene-7-hydroxyheptanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0133176 | HMDB |
| 74853203 | ChemSpider |