EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16O11 |
| Net Charge | 0 |
| Average Mass | 360.271 |
| Monoisotopic Mass | 360.06926 |
| SMILES | COc1cc(C(=O)O)cc(OC2OC(C(=O)O)C(O)C(O)C2O)c1O |
| InChI | InChI=1S/C14H16O11/c1-23-5-2-4(12(19)20)3-6(7(5)15)24-14-10(18)8(16)9(17)11(25-14)13(21)22/h2-3,8-11,14-18H,1H3,(H,19,20)(H,21,22) |
| InChIKey | ILWDNUVZYSRINE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-(5-carboxy-2-hydroxy-3-methoxyphenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid (CHEBI:186729) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 6-(5-carboxy-2-hydroxy-3-methoxyphenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0128022 | HMDB |