EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O2 |
| Net Charge | 0 |
| Average Mass | 230.307 |
| Monoisotopic Mass | 230.13068 |
| SMILES | CCCCC#CC#CC#CCCCCC(=O)O |
| InChI | InChI=1S/C15H18O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h2-4,11-14H2,1H3,(H,16,17) |
| InChIKey | ZRUBGTBVDWZJCR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6,8,10-Pentadecatriynoic acid (CHEBI:186706) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| pentadeca-6,8,10-triynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8808592 | ChemSpider |
| LMFA01031107 | LIPID MAPS |