EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H50O2 |
| Net Charge | 0 |
| Average Mass | 406.695 |
| Monoisotopic Mass | 406.38108 |
| SMILES | CCCCCCCCCCCCCCCCC/C=C\CC/C=C\CCCC(=O)O |
| InChI | InChI=1S/C27H50O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27(28)29/h18-19,22-23H,2-17,20-21,24-26H2,1H3,(H,28,29)/b19-18-,23-22- |
| InChIKey | QHCUSXRHMXVISV-ZCIBKELESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 27:2(5Z,9Z) (CHEBI:186685) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| (5Z,9Z)-heptacosa-5,9-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 23340061 | ChemSpider |
| LMFA01020363 | LIPID MAPS |