EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21NO2S |
| Net Charge | 0 |
| Average Mass | 267.394 |
| Monoisotopic Mass | 267.12930 |
| SMILES | CCC(C)C(C)Nc1cccc(SC)c1C(=O)O |
| InChI | InChI=1S/C14H21NO2S/c1-5-9(2)10(3)15-11-7-6-8-12(18-4)13(11)14(16)17/h6-10,15H,5H2,1-4H3,(H,16,17) |
| InChIKey | MANYMXWFADXBHV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[(3-Methyl-2-pentanyl)amino]-6-(methylsulfanyl)benzoic acid (CHEBI:186589) is a aminobenzoic acid (CHEBI:22495) |
| IUPAC Name |
|---|
| 2-(3-methylpentan-2-ylamino)-6-methylsulanylbenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 72308180 | ChemSpider |