EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H38O3 |
| Net Charge | 0 |
| Average Mass | 314.510 |
| Monoisotopic Mass | 314.28210 |
| SMILES | CCCCCCCC(CCCCCCCCCC(=O)O)OC |
| InChI | InChI=1S/C19H38O3/c1-3-4-5-9-12-15-18(22-2)16-13-10-7-6-8-11-14-17-19(20)21/h18H,3-17H2,1-2H3,(H,20,21) |
| InChIKey | WWDCPOBCECWOAQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Nitrosopumilus maritimus str. SCM1 (ncbitaxon:436308) | cell culture (BTO:0000214) | MetaboLights (MTBLS3714) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-methoxy-octadecanoic acid (CHEBI:186577) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 11-methoxyoctadecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 15834052 | ChemSpider |
| LMFA01080027 | LIPID MAPS |