EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H84O3 |
| Net Charge | 0 |
| Average Mass | 637.131 |
| Monoisotopic Mass | 636.64205 |
| SMILES | CCCCCCCCCCCCCCCCCC(O)[C@H](C)C[C@H](C)C[C@H](C)C[C@H](C)C[C@H](C)C[C@H](C)C[C@H](C)C[C@H](C)C(=O)O |
| InChI | InChI=1S/C42H84O3/c1-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-41(43)39(8)31-37(6)29-35(4)27-33(2)26-34(3)28-36(5)30-38(7)32-40(9)42(44)45/h33-41,43H,10-32H2,1-9H3,(H,44,45)/t33-,34+,35-,36+,37-,38+,39-,40+,41?/m1/s1 |
| InChIKey | GWVUUZNLKZUAHT-FRUGHQICSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nitrosopumilus maritimus str. SCM1 (ncbitaxon:436308) | cell culture (BTO:0000214) | MetaboLights (MTBLS3714) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hydroxyphthioceranic acid (C42) (CHEBI:186573) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| (2S,4S,6S,8S,10R,12R,14R,16R)-17-hydroxy-2,4,6,8,10,12,14,16-octamethyltetratriacontanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113369078 | ChemSpider |
| LMFA01020327 | LIPID MAPS |