EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H35N3O11S |
| Net Charge | 0 |
| Average Mass | 573.621 |
| Monoisotopic Mass | 573.19923 |
| SMILES | CC(C)(SCC(NC(=O)CCC(N)C(=O)O)C(=O)NCC(=O)O)C(O)Cc1cc(CC(O)C(=O)O)ccc1O |
| InChI | InChI=1S/C24H35N3O11S/c1-24(2,18(30)9-13-7-12(3-5-16(13)28)8-17(29)23(37)38)39-11-15(21(34)26-10-20(32)33)27-19(31)6-4-14(25)22(35)36/h3,5,7,14-15,17-18,28-30H,4,6,8-11,25H2,1-2H3,(H,26,34)(H,27,31)(H,32,33)(H,35,36)(H,37,38) |
| InChIKey | GJKZQNHVAICIDG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-4-{[2-({4-[5-(2-carboxy-2-hydroxyethyl)-2-hydroxyphenyl]-3-hydroxy-2-methylbutan-2-yl}sulfanyl)-1-[(carboxymethyl)-C-hydroxycarbonimidoyl]ethyl]-C-hydroxycarbonimidoyl}butanoic acid (CHEBI:186533) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-amino-5-[[3-[4-[5-(2-carboxy-2-hydroxyethyl)-2-hydroxyphenyl]-3-hydroxy-2-methylbutan-2-yl]sulanyl-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0133280 | HMDB |