EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H48O13 |
| Net Charge | 0 |
| Average Mass | 664.745 |
| Monoisotopic Mass | 664.30949 |
| SMILES | COC1C(O)C(O[C@H]2CC[C@]3(C=O)C4C(OC(C)=O)C[C@]5(C)[C@@H](C6=CC(=O)OC6)CC[C@]5(O)C4CC[C@]3(O)C2)OC(C)C1OC(C)=O |
| InChI | InChI=1S/C34H48O13/c1-17-28(46-19(3)37)29(42-5)27(39)30(44-17)47-21-6-9-32(16-35)26-23(7-10-33(32,40)13-21)34(41)11-8-22(20-12-25(38)43-15-20)31(34,4)14-24(26)45-18(2)36/h12,16-17,21-24,26-30,39-41H,6-11,13-15H2,1-5H3/t17?,21-,22+,23?,24?,26?,27?,28?,29?,30?,31+,32-,33-,34-/m0/s1 |
| InChIKey | JJSVXWKQLGHFES-BQRCQHSYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SARMENTOSIDE B (CHEBI:186470) is a cardenolide glycoside (CHEBI:38092) |
| IUPAC Name |
|---|
| [(3S,5S,10S,11R,13R,14S,17R)-3-(5-acetyloxy-3-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-10-ormyl-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-uran-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-11-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 5140689 | ChemSpider |