EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H27N3O8S |
| Net Charge | 0 |
| Average Mass | 457.505 |
| Monoisotopic Mass | 457.15189 |
| SMILES | NC(CCC(=O)NC(CSC(c1ccccc1)C(O)CO)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H27N3O8S/c20-12(19(29)30)6-7-15(25)22-13(18(28)21-8-16(26)27)10-31-17(14(24)9-23)11-4-2-1-3-5-11/h1-5,12-14,17,23-24H,6-10,20H2,(H,21,28)(H,22,25)(H,26,27)(H,29,30) |
| InChIKey | AAIQEZBVKSAGIR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-4-({1-[(carboxymethyl)-C-hydroxycarbonimidoyl]-2-[(2,3-dihydroxy-1-phenylpropyl)sulfanyl]ethyl}-C-hydroxycarbonimidoyl)butanoic acid (CHEBI:186389) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-amino-5-[[1-(carboxymethylamino)-3-(2,3-dihydroxy-1-phenylpropyl)sulanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0135309 | HMDB |