EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16O3 |
| Net Charge | 0 |
| Average Mass | 196.246 |
| Monoisotopic Mass | 196.10994 |
| SMILES | O=C/C=C/CC/C=C\CCCC(=O)O |
| InChI | InChI=1S/C11H16O3/c12-10-8-6-4-2-1-3-5-7-9-11(13)14/h1,3,6,8,10H,2,4-5,7,9H2,(H,13,14)/b3-1-,8-6+ |
| InChIKey | LPCLISDRKJOFGY-CJXSKEFVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-oxo-undeca-5,9-dienoic acid (CHEBI:186322) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (5Z,9E)-11-oxoundeca-5,9-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 28282346 | ChemSpider |
| LMFA01060221 | LIPID MAPS |