EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O4 |
| Net Charge | 0 |
| Average Mass | 130.099 |
| Monoisotopic Mass | 130.02661 |
| SMILES | O=C(O)/C=C/CC(=O)O |
| InChI | InChI=1S/C5H6O4/c6-4(7)2-1-3-5(8)9/h1-2H,3H2,(H,6,7)(H,8,9)/b2-1+ |
| InChIKey | XVOUMQNXTGKGMA-OWOJBTEDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-glutaconic acid (CHEBI:15670) is a glutaconic acid (CHEBI:24309) |
| (E)-glutaconic acid (CHEBI:15670) is conjugate acid of (E)-glutaconate(1−) (CHEBI:36461) |
| Incoming Relation(s) |
| (E)-3-methylglutaconic acid (CHEBI:37245) has functional parent (E)-glutaconic acid (CHEBI:15670) |
| O-glutaconylcarnitine (CHEBI:86081) has functional parent (E)-glutaconic acid (CHEBI:15670) |
| trans-4-carboxybut-2-enoyl-CoA (CHEBI:15497) has functional parent (E)-glutaconic acid (CHEBI:15670) |
| (E)-glutaconate(1−) (CHEBI:36461) is conjugate base of (E)-glutaconic acid (CHEBI:15670) |
| IUPAC Name |
|---|
| (2E)-pent-2-enedioic acid |
| Synonyms | Source |
|---|---|
| (E)-Glutaconate | KEGG COMPOUND |
| (E)-glutaconic acid | ChEBI |
| Glutaconic acid | KEGG COMPOUND |
| trans-Glutaconate | KEGG COMPOUND |
| trans-Glutaconic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C02214 | KEGG COMPOUND |
| GLUTACONATE | MetaCyc |
| Glutaconic_acid | Wikipedia |
| HMDB0000620 | HMDB |
| LMFA01170109 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1722686 | Reaxys |
| CAS:628-48-8 | KEGG COMPOUND |