EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O5 |
| Net Charge | 0 |
| Average Mass | 350.455 |
| Monoisotopic Mass | 350.20932 |
| SMILES | CCCCCC(O)/C=C/C#C/C=C/C=C/C(O)C(O)CCCC(=O)O |
| InChI | InChI=1S/C20H30O5/c1-2-3-8-12-17(21)13-9-6-4-5-7-10-14-18(22)19(23)15-11-16-20(24)25/h5,7,9-10,13-14,17-19,21-23H,2-3,8,11-12,15-16H2,1H3,(H,24,25)/b7-5+,13-9+,14-10+ |
| InChIKey | FGNHRTMSQFGXDG-AWDXSQJBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,6,15-trihydroxy-7,9,13-Eicosatrien-11-ynoic acid (CHEBI:186304) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (7E,9E,13E)-5,6,15-trihydroxyicosa-7,9,13-trien-11-ynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 7822595 | ChemSpider |
| LMFA01030748 | LIPID MAPS |