EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H36O5 |
| Net Charge | 0 |
| Average Mass | 380.525 |
| Monoisotopic Mass | 380.25627 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)C(=O)O)[C@@]1(C)CC[C@]1([H])[C@@]3(C)CC[C@@H](O)C[C@@]3([H])[C@H](O)[C@@H](O)[C@@]21[H] |
| InChI | InChI=1S/C22H36O5/c1-11(20(26)27)13-4-5-14-17-15(7-9-21(13,14)2)22(3)8-6-12(23)10-16(22)18(24)19(17)25/h11-19,23-25H,4-10H2,1-3H3,(H,26,27)/t11-,12+,13+,14-,15-,16-,17-,18-,19-,21+,22+/m0/s1 |
| InChIKey | SNROUEKOYOUQNB-PJFKWEMDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dinor-alpha-muricholic acid (CHEBI:186303) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (2S)-2-[(3R,5R,6S,7S,8S,9S,10R,13S,14S,17R)-3,6,7-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113385545 | ChemSpider |
| LMST04050012 | LIPID MAPS |