EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H37AsO3 |
| Net Charge | 0 |
| Average Mass | 448.479 |
| Monoisotopic Mass | 448.19587 |
| SMILES | C[As](C)(=O)C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C24H37AsO3/c1-25(2,28)23-21-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22-24(26)27/h3-4,7-10,13-16,19,21H,5-6,11-12,17-18,20,22-23H2,1-2H3,(H,26,27)/b4-3-,9-7-,10-8-,15-13-,16-14-,21-19- |
| InChIKey | GJSMHUXGVHPNKH-GANQPYOASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 22-dimethylarsinoyl-(5Z,8Z, 11Z,14Z,17Z,20Z)-docosahexaenoic acid (CHEBI:186277) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| (5Z,8Z,11Z,14Z,17Z,20Z)-22-dimethylarsoryldocosa-5,8,11,14,17,20-hexaenoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113368128 | ChemSpider |
| LMFA00000029 | LIPID MAPS |