EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H24O3 |
| Net Charge | 0 |
| Average Mass | 228.332 |
| Monoisotopic Mass | 228.17254 |
| SMILES | CCCCCC(C/C=C/CCC(=O)O)OC |
| InChI | InChI=1S/C13H24O3/c1-3-4-6-9-12(16-2)10-7-5-8-11-13(14)15/h5,7,12H,3-4,6,8-11H2,1-2H3,(H,14,15)/b7-5+ |
| InChIKey | KBMNVOKQUUZFOO-FNORWQNLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-methoxy-dodec-4-enoic acid (CHEBI:186233) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (E)-7-methoxydodec-4-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9043341 | ChemSpider |
| LMFA01080012 | LIPID MAPS |