EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19N3S |
| Net Charge | 0 |
| Average Mass | 261.394 |
| Monoisotopic Mass | 261.12997 |
| SMILES | CN(C)CCN(Cc1ccsc1)c1ccccn1 |
| InChI | InChI=1S/C14H19N3S/c1-16(2)8-9-17(11-13-6-10-18-12-13)14-5-3-4-7-15-14/h3-7,10,12H,8-9,11H2,1-2H3 |
| InChIKey | RCGYDFVCAAKKNG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thenyldiamine (CHEBI:186232) is a dialkylarylamine (CHEBI:23665) |
| Thenyldiamine (CHEBI:186232) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N,N-dimethyl-N'-pyridin-2-yl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine |
| Manual Xrefs | Databases |
|---|---|
| 6799 | ChemSpider |
| DB16022 | DrugBank |
| HMDB0240241 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:91-79-2 | ChemIDplus |