EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O5 |
| Net Charge | 0 |
| Average Mass | 238.239 |
| Monoisotopic Mass | 238.08412 |
| SMILES | C/C=C/c1oc(CCC(=O)O)c(C(=O)O)c1C |
| InChI | InChI=1S/C12H14O5/c1-3-4-8-7(2)11(12(15)16)9(17-8)5-6-10(13)14/h3-4H,5-6H2,1-2H3,(H,13,14)(H,15,16)/b4-3+ |
| InChIKey | GTXDMFICGCDJOC-ONEGZZNKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-carboxy-4-methyl-5-propylene-2-furanpropanoic acid (CHEBI:186135) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 2-(2-carboxyethyl)-4-methyl-5-[(E)-prop-1-enyl]uran-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 113368405 | ChemSpider |
| LMFA01150065 | LIPID MAPS |