EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O4 |
| Net Charge | 0 |
| Average Mass | 194.186 |
| Monoisotopic Mass | 194.05791 |
| SMILES | O=C(O)/C=C\C=C/C=C\C=C\C(=O)O |
| InChI | InChI=1S/C10H10O4/c11-9(12)7-5-3-1-2-4-6-8-10(13)14/h1-8H,(H,11,12)(H,13,14)/b3-1-,4-2-,7-5-,8-6+ |
| InChIKey | QHYKVJVPIJCRRT-URDDPPBGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2E,4Z,6Z,8Z-Decatetraenedioic acid (CHEBI:186128) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2Z,4Z,6Z,8E)-deca-2,4,6,8-tetraenedioic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01170004 | LIPID MAPS |
| 7822602 | ChemSpider |