EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34O2 |
| Net Charge | 0 |
| Average Mass | 342.523 |
| Monoisotopic Mass | 342.25588 |
| SMILES | CCCC#CCCCCCCCCC/C=C/C=C\C#CCCC(=O)O |
| InChI | InChI=1S/C23H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25/h15-18H,2-3,6-14,21-22H2,1H3,(H,24,25)/b16-15+,18-17- |
| InChIKey | ACLJSIICSRNJNW-FQASWMIKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6Z,8E-tricosdien-4,19-diynoic acid (CHEBI:186116) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| (6Z,8E)-tricosa-6,8-dien-4,19-diynoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01031128 | LIPID MAPS |
| 8625512 | ChemSpider |