EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O6 |
| Net Charge | 0 |
| Average Mass | 350.411 |
| Monoisotopic Mass | 350.17294 |
| SMILES | [H][C@@]12CC[C@H](O)[C@@]1(C)CCC(=O)[C@H]2CCC(=O)/C(C)=C\C=C(\O)C(=O)O |
| InChI | InChI=1S/C19H26O6/c1-11(3-6-16(22)18(24)25)14(20)7-4-12-13-5-8-17(23)19(13,2)10-9-15(12)21/h3,6,12-13,17,22-23H,4-5,7-10H2,1-2H3,(H,24,25)/b11-3-,16-6+/t12-,13-,17-,19-/m0/s1 |
| InChIKey | VFZJOUAHKAQPBP-VQFZKUMASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,17-dihydroxy-5,9-dioxo-4,5-9,10-diseco-androsta-1(10),2-dien-4-oic acid (CHEBI:186108) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| (2E,4Z)-8-[(1S,3aS,4S,7aS)-1-hydroxy-7a-methyl-5-oxo-2,3,3a,4,6,7-hexahydro-1H-inden-4-yl]-2-hydroxy-5-methyl-6-oxoocta-2,4-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113385444 | ChemSpider |
| LMST02020117 | LIPID MAPS |