EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15N3O2S.2HCl |
| Net Charge | 0 |
| Average Mass | 278.205 |
| Monoisotopic Mass | 277.04185 |
| SMILES | CS/C(N)=N\CCC[C@H](N)C(=O)O.Cl.Cl |
| InChI | InChI=1S/C7H15N3O2S.2ClH/c1-13-7(9)10-4-2-3-5(8)6(11)12;;/h5H,2-4,8H2,1H3,(H2,9,10)(H,11,12);2*1H/t5-;;/m0../s1 |
| InChIKey | JNZHDSKJUXGYRG-XRIGFGBMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-methyl-L-Thiocitrulline (hydrochloride) (CHEBI:186037) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2-amino-5-[[amino(methylsulanyl)methylidene]amino]pentanoic acid;dihydrochloride |
| Manual Xrefs | Databases |
|---|---|
| 2015296 | ChemSpider |