EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H32O7 |
| Net Charge | 0 |
| Average Mass | 516.590 |
| Monoisotopic Mass | 516.21480 |
| SMILES | CC1=CC(c2c(O)cccc2O)C(C(=O)c2ccc(O)c(/C=C/C(C)C)c2O)C(c2ccc(O)cc2O)C1 |
| InChI | InChI=1S/C31H32O7/c1-16(2)7-9-20-24(33)12-11-21(30(20)37)31(38)28-22(19-10-8-18(32)15-27(19)36)13-17(3)14-23(28)29-25(34)5-4-6-26(29)35/h4-12,14-16,22-23,28,32-37H,13H2,1-3H3/b9-7+ |
| InChIKey | NYDDZMHXNRKMBY-VQHVLOKHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(6-{2,4-dihydroxy-3-[(1E)-3-methylbut-1-en-1-yl]benzoyl}-5-(2,4-dihydroxyphenyl)-3-methylcyclohex-2-en-1-yl)benzene-1,3-diol (CHEBI:186017) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| [2,4-dihydroxy-3-[(E)-3-methylbut-1-enyl]phenyl]-[6-(2,4-dihydroxyphenyl)-2-(2,6-dihydroxyphenyl)-4-methylcyclohex-3-en-1-yl]methanone |
| Manual Xrefs | Databases |
|---|---|
| HMDB0126448 | HMDB |