EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25N3O9S |
| Net Charge | 0 |
| Average Mass | 471.488 |
| Monoisotopic Mass | 471.13115 |
| SMILES | NC(CCC(=O)NC(CSC(C(=O)O)C(O)c1ccccc1)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H25N3O9S/c20-11(18(28)29)6-7-13(23)22-12(17(27)21-8-14(24)25)9-32-16(19(30)31)15(26)10-4-2-1-3-5-10/h1-5,11-12,15-16,26H,6-9,20H2,(H,21,27)(H,22,23)(H,24,25)(H,28,29)(H,30,31) |
| InChIKey | DFQJEOHFPWLUOY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-4-({2-[(1-carboxy-2-hydroxy-2-phenylethyl)sulfanyl]-1-[(carboxymethyl)-C-hydroxycarbonimidoyl]ethyl}-C-hydroxycarbonimidoyl)butanoic acid (CHEBI:185970) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-amino-5-[[3-(1-carboxy-2-hydroxy-2-phenylethyl)sulanyl-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0126550 | HMDB |