EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O2 |
| Net Charge | 0 |
| Average Mass | 196.290 |
| Monoisotopic Mass | 196.14633 |
| SMILES | CCC/C=C/CCCC/C=C/C(=O)O |
| InChI | InChI=1S/C12H20O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h4-5,10-11H,2-3,6-9H2,1H3,(H,13,14)/b5-4+,11-10+ |
| InChIKey | FWXDEWYURMQUOL-PMXBNEBOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2E,8E-dodecadienoic acid (CHEBI:185954) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,8E)-dodeca-2,8-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4471809 | ChemSpider |
| LMFA01030232 | LIPID MAPS |