EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8F3NO3 |
| Net Charge | 0 |
| Average Mass | 247.172 |
| Monoisotopic Mass | 247.04563 |
| SMILES | O=C(O)CNC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8F3NO3/c11-10(12,13)7-3-1-2-6(4-7)9(17)14-5-8(15)16/h1-4H,5H2,(H,14,17)(H,15,16) |
| InChIKey | ZDGGJQMSELMHLK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| m-Trifluoromethylhippuric acid (CHEBI:185887) has functional parent N-benzoylglycine (CHEBI:18089) |
| m-Trifluoromethylhippuric acid (CHEBI:185887) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| 2-[[3-(triluoromethyl)benzoyl]amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 2057711 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:17794-48-8 | ChemIDplus |