EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H20O6 |
| Net Charge | 0 |
| Average Mass | 404.418 |
| Monoisotopic Mass | 404.12599 |
| SMILES | O=C1CC(c2ccc(O)cc2)c2c(O)cc(O)c(C(=O)CCc3ccccc3)c2O1 |
| InChI | InChI=1S/C24H20O6/c25-16-9-7-15(8-10-16)17-12-21(29)30-24-22(17)19(27)13-20(28)23(24)18(26)11-6-14-4-2-1-3-5-14/h1-5,7-10,13,17,25,27-28H,6,11-12H2 |
| InChIKey | LEHQNGMIHPACJG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Calomelanol C (CHEBI:185821) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-4-(4-hydroxyphenyl)-8-(3-phenylpropanoyl)-3,4-dihydrochromen-2-one |
| Manual Xrefs | Databases |
|---|---|
| 9179176 | ChemSpider |
| LMPK12120496 | LIPID MAPS |