EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO4 |
| Net Charge | 0 |
| Average Mass | 183.163 |
| Monoisotopic Mass | 183.05316 |
| SMILES | CC(NC(=O)c1ccco1)C(=O)O |
| InChI | InChI=1S/C8H9NO4/c1-5(8(11)12)9-7(10)6-3-2-4-13-6/h2-5H,1H3,(H,9,10)(H,11,12) |
| InChIKey | VNYWJRJEGHPIQW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl(2-furoylamino)acetic acid (CHEBI:185817) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-(uran-2-carbonylamino)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 2105504 | ChemSpider |