EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42F2O2 |
| Net Charge | 0 |
| Average Mass | 436.627 |
| Monoisotopic Mass | 436.31529 |
| SMILES | C=C1CCC(O)C/C1=C/C=C1/CCCC2(C)C1CCC2C(C)CC(F)(F)CC(C)(C)O |
| InChI | InChI=1S/C27H42F2O2/c1-18-8-11-22(30)15-21(18)10-9-20-7-6-14-26(5)23(12-13-24(20)26)19(2)16-27(28,29)17-25(3,4)31/h9-10,19,22-24,30-31H,1,6-8,11-17H2,2-5H3/b20-9-,21-10- |
| InChIKey | QHPKSIWDAYRSIM-UPVMUGGESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 23,23-difluoro-25-hydroxyvitamin D3 (CHEBI:185803) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (3Z)-3-[(2Z)-2-[1-(4,4-diluoro-6-hydroxy-6-methylheptan-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
| Manual Xrefs | Databases |
|---|---|
| 4943111 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:95826-03-2 | ChemIDplus |