EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9N3O3 |
| Net Charge | 0 |
| Average Mass | 147.134 |
| Monoisotopic Mass | 147.06439 |
| SMILES | NC(=O)NCC(N)C(=O)O |
| InChI | InChI=1S/C4H9N3O3/c5-2(3(8)9)1-7-4(6)10/h2H,1,5H2,(H,8,9)(H3,6,7,10) |
| InChIKey | GZYFIMLSHBLMKF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ALBIZZIINE (CHEBI:185775) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-3-(carbamoylamino)propanoic acid |