EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H36NO8S.Na |
| Net Charge | 0 |
| Average Mass | 461.553 |
| Monoisotopic Mass | 461.20593 |
| SMILES | CCCCCCC(=O)CCCCCCCC[C@@H](OS(=O)(=O)[O-])[C@@](N)(CO)C(=O)O.[Na+] |
| InChI | InChI=1S/C19H37NO8S.Na/c1-2-3-4-9-12-16(22)13-10-7-5-6-8-11-14-17(28-29(25,26)27)19(20,15-21)18(23)24;/h17,21H,2-15,20H2,1H3,(H,23,24)(H,25,26,27);/q;+1/p-1/t17-,19+;/m1./s1 |
| InChIKey | PGDNRSKECWNWIQ-ZFNKBKEPSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sulfamisterin (CHEBI:185769) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| sodium;[(2S,3R)-2-amino-2-carboxy-1-hydroxy-12-oxooctadecan-3-yl] sulate |
| Manual Xrefs | Databases |
|---|---|
| 24823220 | ChemSpider |
| LMSP01080021 | LIPID MAPS |