EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H40O9 |
| Net Charge | 0 |
| Average Mass | 520.619 |
| Monoisotopic Mass | 520.26723 |
| SMILES | CC1=C(C)C(=O)OC(C(C)(O)C2(O)CCC3(O)C4CC(O)C5(O)C(O)C=CC(=O)C5(C)C4CCC32C)C1 |
| InChI | InChI=1S/C28H40O9/c1-14-12-21(37-22(32)15(14)2)25(5,33)27(35)11-10-26(34)17-13-20(31)28(36)19(30)7-6-18(29)24(28,4)16(17)8-9-23(26,27)3/h6-7,16-17,19-21,30-31,33-36H,8-13H2,1-5H3 |
| InChIKey | XLUKITCTLVOOAW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Withaperuvin B (CHEBI:185755) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| 2-[1-hydroxy-1-(4,5,6,14,17-pentahydroxy-10,13-dimethyl-1-oxo-6,7,8,9,11,12,15,16-octahydro-4H-cyclopenta[a]phenanthren-17-yl)ethyl]-4,5-dimethyl-2,3-dihydropyran-6-one |
| Manual Xrefs | Databases |
|---|---|
| 2965197 | ChemSpider |
| HMDB0034191 | HMDB |
| LMST01160021 | LIPID MAPS |