EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28O4 |
| Net Charge | 0 |
| Average Mass | 308.418 |
| Monoisotopic Mass | 308.19876 |
| SMILES | CCC1=C(/C=C/[C@@H](O)CCCCCCCC(=O)O)CCC1=O |
| InChI | InChI=1S/C18H28O4/c1-2-16-14(11-13-17(16)20)10-12-15(19)8-6-4-3-5-7-9-18(21)22/h10,12,15,19H,2-9,11,13H2,1H3,(H,21,22)/b12-10+/t15-/m0/s1 |
| InChIKey | KXMANOZDITZERP-PABFRNLHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-L1-PhytoP (CHEBI:185700) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (E,9S)-11-(2-ethyl-3-oxocyclopenten-1-yl)-9-hydroxyundec-10-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113369220 | ChemSpider |
| LMFA02030005 | LIPID MAPS |