EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H36O3 |
| Net Charge | 0 |
| Average Mass | 372.549 |
| Monoisotopic Mass | 372.26645 |
| SMILES | [H][C@]12CC[C@]3([H])C(=CC[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)CCC(=O)O)[C@@]1(C)CCC(=O)C2 |
| InChI | InChI=1S/C24H36O3/c1-15(4-9-22(26)27)19-7-8-20-18-6-5-16-14-17(25)10-12-23(16,2)21(18)11-13-24(19,20)3/h11,15-16,18-20H,4-10,12-14H2,1-3H3,(H,26,27)/t15-,16-,18+,19-,20+,23+,24-/m1/s1 |
| InChIKey | TYXMQFBZGAEZPJ-JVYWEBAWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Oxo-5beta-chol-9(11)-en-24-oic Acid (CHEBI:185648) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (4R)-4-[(5R,8S,10S,13R,14S,17R)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4447134 | ChemSpider |
| LMST04010293 | LIPID MAPS |