EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H30O7 |
| Net Charge | 0 |
| Average Mass | 490.552 |
| Monoisotopic Mass | 490.19915 |
| SMILES | COC(=O)c1ccc(O)c(C(C=C(C)C)c2c(OC)cc(O)c(C(=O)CCc3ccccc3)c2O)c1 |
| InChI | InChI=1S/C29H30O7/c1-17(2)14-21(20-15-19(29(34)36-4)11-13-22(20)30)26-25(35-3)16-24(32)27(28(26)33)23(31)12-10-18-8-6-5-7-9-18/h5-9,11,13-16,21,30,32-33H,10,12H2,1-4H3 |
| InChIKey | UWDJCYWVPNETPR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Piperaduncin A (CHEBI:185620) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| methyl 3-[1-[2,4-dihydroxy-6-methoxy-3-(3-phenylpropanoyl)phenyl]-3-methylbut-2-enyl]-4-hydroxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| 8656132 | ChemSpider |
| LMPK12120474 | LIPID MAPS |