EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O5 |
| Net Charge | 0 |
| Average Mass | 378.509 |
| Monoisotopic Mass | 378.24062 |
| SMILES | CC[C@H](O)/C=C/[C@H]1[C@@H](C/C=C\C/C=C\C/C=C\CCC(=O)O)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C22H34O5/c1-2-17(23)14-15-19-18(20(24)16-21(19)25)12-10-8-6-4-3-5-7-9-11-13-22(26)27/h3-4,7-10,14-15,17-21,23-25H,2,5-6,11-13,16H2,1H3,(H,26,27)/b4-3-,9-7-,10-8-,15-14+/t17-,18+,19-,20+,21-/m0/s1 |
| InChIKey | CJWASNYUTHNACM-UHLVPQFFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ent-20-epi-20-F4t-NeuroP (CHEBI:185589) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (4Z,7Z,10Z)-12-[(1R,2S,3S,5R)-3,5-dihydroxy-2-[(E,3S)-3-hydroxypent-1-enyl]cyclopentyl]dodeca-4,7,10-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113370150 | ChemSpider |
| LMFA04010127 | LIPID MAPS |