EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H40O8 |
| Net Charge | 0 |
| Average Mass | 504.620 |
| Monoisotopic Mass | 504.27232 |
| SMILES | CC1C(=O)OC(C(O)C(C)(O)C2C(O)CC3C4CC5OC56C(O)C=CC(=O)C6(C)C4CCC32C)C1C |
| InChI | InChI=1S/C28H40O8/c1-12-13(2)24(33)35-21(12)23(32)27(5,34)22-17(29)11-16-14-10-20-28(36-20)19(31)7-6-18(30)26(28,4)15(14)8-9-25(16,22)3/h6-7,12-17,19-23,29,31-32,34H,8-11H2,1-5H3 |
| InChIKey | PHBPDHFIJFLEGD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ixocarpalactone A (CHEBI:185561) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| 15-[1-(3,4-dimethyl-5-oxooxolan-2-yl)-1,2-dihydroxypropan-2-yl]-6,14-dihydroxy-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-4-en-3-one |
| Manual Xrefs | Databases |
|---|---|
| 289842 | ChemSpider |
| HMDB0034393 | HMDB |
| LMST01160011 | LIPID MAPS |