EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H18O5 |
| Net Charge | 0 |
| Average Mass | 386.403 |
| Monoisotopic Mass | 386.11542 |
| SMILES | O=C1CC(c2ccccc2)c2c(O)cc(O)c(C(=O)/C=C/c3ccccc3)c2O1 |
| InChI | InChI=1S/C24H18O5/c25-18(12-11-15-7-3-1-4-8-15)23-20(27)14-19(26)22-17(13-21(28)29-24(22)23)16-9-5-2-6-10-16/h1-12,14,17,26-27H,13H2/b12-11+ |
| InChIKey | XNMQCWKDPWDEMC-VAWYXSNFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-Cinnamoyl-3,4-dihydro-5,7-dihydroxy-4-phenylcoumarin (CHEBI:185494) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-4-phenyl-8-[(E)-3-phenylprop-2-enoyl]-3,4-dihydrochromen-2-one |
| Manual Xrefs | Databases |
|---|---|
| 24845964 | ChemSpider |
| LMPK12120227 | LIPID MAPS |