EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H24O2 |
| Net Charge | 0 |
| Average Mass | 224.344 |
| Monoisotopic Mass | 224.17763 |
| SMILES | CCCCCCCC#CCCCCC(=O)O |
| InChI | InChI=1S/C14H24O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-7,10-13H2,1H3,(H,15,16) |
| InChIKey | ZLVZZNAVHZNAEK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-tetradecynoic acid (CHEBI:185466) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| tetradec-6-ynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472133 | ChemSpider |
| LMFA01030587 | LIPID MAPS |