EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H48O5 |
| Net Charge | 0 |
| Average Mass | 464.687 |
| Monoisotopic Mass | 464.35017 |
| SMILES | [H][C@@]12COC(=O)[C@@]3([H])C[C@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)[C@@H](O)[C@H](O)[C@@H](C)C(C)C |
| InChI | InChI=1S/C28H48O5/c1-15(2)16(3)24(30)25(31)17(4)20-7-8-21-19-14-33-26(32)23-13-18(29)9-11-28(23,6)22(19)10-12-27(20,21)5/h15-25,29-31H,7-14H2,1-6H3/t16-,17-,18+,19-,20+,21-,22-,23+,24+,25+,27+,28+/m0/s1 |
| InChIKey | LLFIMDUWAVPJEJ-AVWWTISCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Sus scrofa domesticus (ncbitaxon:9825) | - | PubMed (33833350) | Identified in the colon. |
| Apium graveolens (ncbitaxon:4045) | - | DOI (10.1016/0031-9422(95)00363-C) |
| Roles Classification |
|---|
| Biological Roles: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-oxatyphasterol (CHEBI:185407) has role mammalian metabolite (CHEBI:75768) |
| 7-oxatyphasterol (CHEBI:185407) has role plant growth stimulator (CHEBI:26157) |
| 7-oxatyphasterol (CHEBI:185407) has role plant hormone (CHEBI:37848) |
| 7-oxatyphasterol (CHEBI:185407) has role plant metabolite (CHEBI:76924) |
| 7-oxatyphasterol (CHEBI:185407) is a 22-hydroxy steroid (CHEBI:36863) |
| 7-oxatyphasterol (CHEBI:185407) is a 23-hydroxy steroid (CHEBI:36866) |
| 7-oxatyphasterol (CHEBI:185407) is a 3α-hydroxy steroid (CHEBI:36835) |
| 7-oxatyphasterol (CHEBI:185407) is a brassinosteroid (CHEBI:22921) |
| IUPAC Name |
|---|
| (3aS,5R,7aR,7bS,9aS,10R,12aS,12bS)-10-[(2S,3R,4R,5S)-3,4-dihydroxy-5,6-dimethylheptan-2-yl]-5-hydroxy-7a,9a-dimethylhexadecahydro-3H-benzo[c]indeno[5,4-e]oxepin-3-one |
| Synonyms | Source |
|---|---|
| (22R,23R,24S)-3α,22,23-trihydroxy-7-oxa-5α-ergostane-6-one | KEGG COMPOUND |
| (1S,2R,5R,7S,11S,12S,15R,16S)-15-[(2S,3R,4R,5S)-3,4-dihydroxy-5,6-dimethylheptan-2-yl]-5-hydroxy-2,16-dimethyl-9-oxatetracyclo[9.7.0.02,7.012,16]octadecan-8-one | IUPAC |
| 2-deoxybrassinolide | ChEBI |
| 7-oxotyphasterol | LIPID MAPS |
| 3α,22R,23R-trihydroxy-6,7-seco-5α-campestano-6,7-lactone | LIPID MAPS |
| UniProt Name | Source |
|---|---|
| 7-oxatyphasterol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C17735 | KEGG COMPOUND |
| HMDB0041135 | HMDB |
| 103882371 | ChemSpider |
| LMST01140003 | LIPID MAPS |
| CPD-12497 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:144071-55-6 | ChEBI |
| Citations |
|---|