EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H38N2O6S |
| Net Charge | 0 |
| Average Mass | 446.610 |
| Monoisotopic Mass | 446.24506 |
| SMILES | CCCCCCC(C(/C=C/CCCCCCCC(=O)O)SC[C@H](N)C(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C21H38N2O6S/c1-2-3-4-10-13-18(23(28)29)19(30-16-17(22)21(26)27)14-11-8-6-5-7-9-12-15-20(24)25/h11,14,17-19H,2-10,12-13,15-16,22H2,1H3,(H,24,25)(H,26,27)/b14-11+/t17-,18?,19?/m0/s1 |
| InChIKey | DNZGGYIFHBHZNM-OKCJRLRQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-cys-12-nitro-octadecenoic acid (CHEBI:185391) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (E)-11-[(2R)-2-amino-2-carboxyethyl]sulanyl-12-nitrooctadec-9-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113369154 | ChemSpider |
| LMFA01120014 | LIPID MAPS |