EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H35N3O12S |
| Net Charge | 0 |
| Average Mass | 589.620 |
| Monoisotopic Mass | 589.19414 |
| SMILES | COc1c(CC(=O)O)c(O)cc(O)c1CC(O)C(C)(C)SCC(NC(=O)CCC(N)C(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C24H35N3O12S/c1-24(2,17(30)6-11-15(28)8-16(29)12(7-19(32)33)21(11)39-3)40-10-14(22(36)26-9-20(34)35)27-18(31)5-4-13(25)23(37)38/h8,13-14,17,28-30H,4-7,9-10,25H2,1-3H3,(H,26,36)(H,27,31)(H,32,33)(H,34,35)(H,37,38) |
| InChIKey | RZQHGPRGZNSTOU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | spermatozoon (BTO:0001277) | MetaboLights (MTBLS1071) | Strain: Holstein [LBO:0000132] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-4-{[2-({4-[3-(carboxymethyl)-4,6-dihydroxy-2-methoxyphenyl]-3-hydroxy-2-methylbutan-2-yl}sulfanyl)-1-[(carboxymethyl)-C-hydroxycarbonimidoyl]ethyl]-C-hydroxycarbonimidoyl}butanoic acid (CHEBI:185373) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-amino-5-[[1-(carboxymethylamino)-3-[4-[3-(carboxymethyl)-4,6-dihydroxy-2-methoxyphenyl]-3-hydroxy-2-methylbutan-2-yl]sulanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0125503 | HMDB |