EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H44O4 |
| Net Charge | 0 |
| Average Mass | 420.634 |
| Monoisotopic Mass | 420.32396 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])C[C@H](O)[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC(=O)CC)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C26H44O4/c1-5-17(27)7-6-15(2)19-8-9-20-24-21(14-23(30)26(19,20)4)25(3)11-10-18(28)12-16(25)13-22(24)29/h15-16,18-24,28-30H,5-14H2,1-4H3/t15-,16+,18-,19-,20+,21+,22-,23+,24+,25+,26-/m1/s1 |
| InChIKey | AAOYRDOLIWFRIW-MKRBMIMYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3Alpha,7Alpha,12Alpha-trihydroxy-27-nor-5Beta-cholestan-24-one (CHEBI:185358) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (6R)-6-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptan-3-one |
| Manual Xrefs | Databases |
|---|---|
| LMST04020001 | LIPID MAPS |
| 2497522 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:61628-32-8 | ChemIDplus |