EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O10 |
| Net Charge | 0 |
| Average Mass | 332.261 |
| Monoisotopic Mass | 332.07435 |
| SMILES | O=C(O)c1cc(O)c(O)c(OC2OC(CO)C(O)C(O)C2O)c1 |
| InChI | InChI=1S/C13H16O10/c14-3-7-9(17)10(18)11(19)13(23-7)22-6-2-4(12(20)21)1-5(15)8(6)16/h1-2,7,9-11,13-19H,3H2,(H,20,21) |
| InChIKey | XRCRYNCPNYQMOB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Glucogallic acid (CHEBI:185330) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 3,4-dihydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0039322 | HMDB |
| 16055795 | ChemSpider |