EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13NO6 |
| Net Charge | 0 |
| Average Mass | 315.281 |
| Monoisotopic Mass | 315.07429 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)Nc1ccc(O)cc1C(=O)O |
| InChI | InChI=1S/C16H13NO6/c18-10-3-4-12(11(8-10)16(22)23)17-15(21)6-2-9-1-5-13(19)14(20)7-9/h1-8,18-20H,(H,17,21)(H,22,23)/b6-2+ |
| InChIKey | IDUUXROOZBOOPH-QHHAFSJGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | spermatozoon (BTO:0001277) | MetaboLights (MTBLS1071) | Strain: Holstein [LBO:0000132] |
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-{[(2E)-3-(3,4-dihydroxyphenyl)-1-hydroxyprop-2-en-1-ylidene]amino}-5-hydroxybenzoic acid (CHEBI:185306) is a alkaloid (CHEBI:22315) |
| 2-{[(2E)-3-(3,4-dihydroxyphenyl)-1-hydroxyprop-2-en-1-ylidene]amino}-5-hydroxybenzoic acid (CHEBI:185306) is a benzamides (CHEBI:22702) |
| IUPAC Name |
|---|
| 2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]-5-hydroxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9897916 | ChemSpider |
| HMDB0038576 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:116764-15-9 | ChemIDplus |