EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O6 |
| Net Charge | 0 |
| Average Mass | 354.443 |
| Monoisotopic Mass | 354.20424 |
| SMILES | CCCCC/C=C/CC1/C(=C/C(CCCC(=O)O)OO)C2CC1OO2 |
| InChI | InChI=1S/C19H30O6/c1-2-3-4-5-6-7-10-15-16(18-13-17(15)24-25-18)12-14(23-22)9-8-11-19(20)21/h6-7,12,14-15,17-18,22H,2-5,8-11,13H2,1H3,(H,20,21)/b7-6+,16-12- |
| InChIKey | RMDWPORTSLRMPB-SDHWVOLWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroperoxy-7-[3,5-epidioxy-2-(2-octenyl)-cyclopentyl]-6-heptenoic acid (CHEBI:185277) is a hydroperoxy polyunsaturated fatty acid (CHEBI:189832) |
| IUPAC Name |
|---|
| (6Z)-5-hydroperoxy-6-[6-[(E)-oct-2-enyl]-2,3-dioxabicyclo[2.2.1]heptan-5-ylidene]hexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4445995 | ChemSpider |
| LMFA01040028 | LIPID MAPS |