EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31NO15S2 |
| Net Charge | 0 |
| Average Mass | 613.616 |
| Monoisotopic Mass | 613.11351 |
| SMILES | CC(=O)OC1C(C)OC(Oc2ccc(C/C(=N\OS(=O)(=O)O)SC3OC(CO)C(O)C(O)C3O)cc2)C(O)C1O |
| InChI | InChI=1S/C22H31NO15S2/c1-9-20(35-10(2)25)17(28)18(29)21(34-9)36-12-5-3-11(4-6-12)7-14(23-38-40(31,32)33)39-22-19(30)16(27)15(26)13(8-24)37-22/h3-6,9,13,15-22,24,26-30H,7-8H2,1-2H3,(H,31,32,33)/b23-14+ |
| InChIKey | GYVDCHYBTDOMRS-OEAKJJBVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | spermatozoon (BTO:0001277) | MetaboLights (MTBLS1071) | Strain: Holstein [LBO:0000132] |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| {[(e)-[2-(4-{[5-(acetyloxy)-3,4-dihydroxy-6-methyloxan-2-yl]oxy}phenyl)-1-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanyl}ethylidene]amino]oxy}sulfonic acid (CHEBI:185253) is a alkylglucosinolate (CHEBI:36445) |
| IUPAC Name |
|---|
| [4,5-dihydroxy-2-methyl-6-[4-[(2E)-2-sulooxyimino-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulanylethyl]phenoxy]oxan-3-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0036939 | HMDB |