EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H31NO14S3 |
| Net Charge | 0 |
| Average Mass | 641.695 |
| Monoisotopic Mass | 641.09067 |
| SMILES | COc1cc(/C=C/C(=O)OCC2OC(S/C(CC/C=C/S(C)=O)=N/OS(=O)(=O)O)C(O)C(O)C2O)cc(OC)c1O |
| InChI | InChI=1S/C23H31NO14S3/c1-34-14-10-13(11-15(35-2)19(14)26)7-8-18(25)36-12-16-20(27)21(28)22(29)23(37-16)39-17(24-38-41(31,32)33)6-4-5-9-40(3)30/h5,7-11,16,20-23,26-29H,4,6,12H2,1-3H3,(H,31,32,33)/b8-7+,9-5+,24-17+ |
| InChIKey | ZXXHJOWBIQIEDP-FKHFMQJFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bos taurus (ncbitaxon:9913) | spermatozoon (BTO:0001277) | MetaboLights (MTBLS1071) | Strain: Holstein [LBO:0000132] |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| {[(e)-[(4E)-5-methanesulfinyl-1-{[3,4,5-trihydroxy-6-({[(2E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxy}methyl)oxan-2-yl]sulfanyl}pent-4-en-1-ylidene]amino]oxy}sulfonic acid (CHEBI:185249) is a alkylglucosinolate (CHEBI:36445) |
| IUPAC Name |
|---|
| [3,4,5-trihydroxy-6-[(E)-C-[(E)-4-methylsulinylbut-3-enyl]-N-sulooxycarbonimidoyl]sulanyloxan-2-yl]methyl (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 35014565 | ChemSpider |
| HMDB0038405 | HMDB |