EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H38O5 |
| Net Charge | 0 |
| Average Mass | 358.519 |
| Monoisotopic Mass | 358.27192 |
| SMILES | CCCCCC(O)C(/C=C/C(CCCCCCCC(=O)O)OC)OC |
| InChI | InChI=1S/C20H38O5/c1-4-5-9-13-18(21)19(25-3)16-15-17(24-2)12-10-7-6-8-11-14-20(22)23/h15-19,21H,4-14H2,1-3H3,(H,22,23)/b16-15+ |
| InChIKey | NMFUHXXKMLKRGE-FOCLMDBBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9,12-dimethoxy-13-hydroxy-10-octadecenoic acid (CHEBI:185229) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (E)-13-hydroxy-9,12-dimethoxyoctadec-10-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4446152 | ChemSpider |
| LMFA01080005 | LIPID MAPS |