EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO2 |
| Net Charge | 0 |
| Average Mass | 129.159 |
| Monoisotopic Mass | 129.07898 |
| SMILES | CC[C@@H]1C[C@@]1(N)C(=O)O |
| InChI | InChI=1S/C6H11NO2/c1-2-4-3-6(4,7)5(8)9/h4H,2-3,7H2,1H3,(H,8,9)/t4-,6+/m1/s1 |
| InChIKey | RLHIWMRQDUCBDO-XINAWCOVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,2R)-1-amino-2-ethylcyclopropanecarboxylic acid (CHEBI:18511) is a 1-amino-2-ethylcyclopropanecarboxylic acid (CHEBI:19023) |
| IUPAC Name |
|---|
| (1S,2R)-1-amino-2-ethylcyclopropanecarboxylic acid |
| Synonym | Source |
|---|---|
| (+)-(1S,2R)-allocoronamic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4660426 | Beilstein |